C12H17Cl2NS — CID 63983384
N-[1-(2,5-dichlorophenyl)ethyl]-3-methylsulfanylpropan-1-amine (PubChem CID 63983384) has the molecular formula C12H17Cl2NS and a molecular weight of 278.25 g/mol. Its IUPAC name is N-[1-(2,5-dichlorophenyl)ethyl]-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[1-(2,5-dichlorophenyl)ethyl]-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 63983384 |
| Molecular Formula | C12H17Cl2NS |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-[1-(2,5-dichlorophenyl)ethyl]-3-methylsulfanylpropan-1-amine |
| SMILES | CSCCCNC(C)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H17Cl2NS/c1-9(15-6-3-7-16-2)11-8-10(13)4-5-12(11)14/h4-5,8-9,15H,3,6-7H2,1-2H3 |
| InChIKey | OWORYZFPRAUUKE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|