About 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine
1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine (PubChem CID 63983745) has the molecular formula C14H26N2S
and a molecular weight of 254.44 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine |
| PubChem CID | 63983745 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine |
| SMILES | CCC(C)(C)N(C)C(CN)c1cc(C)sc1C |
| InChI | InChI=1S/C14H26N2S/c1-7-14(4,5)16(6)13(9-15)12-8-10(2)17-11(12)3/h8,13H,7,9,15H2,1-6H3 |
| InChIKey | HGYUFRCLNSPMNU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine?
The IUPAC name of 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine (CID 63983745) is 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine?
The canonical SMILES for 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine is CCC(C)(C)N(C)C(CN)c1cc(C)sc1C.
What is the InChIKey of 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine?
The InChIKey is HGYUFRCLNSPMNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2S/c1-7-14(4,5)16(6)13(9-15)12-8-10(2)17-11(12)3/h8,13H,7,9,15H2,1-6H3.
What are the key properties of 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine?
1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine has a molecular weight of 254.44 g/mol, XLogP of 3.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylthiophen-3-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 63983745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).