About 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine
1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine (PubChem CID 63982675) has the molecular formula C12H20Br2N2O
and a molecular weight of 368.11 g/mol. Its IUPAC name is 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine |
| PubChem CID | 63982675 |
| Molecular Formula | C12H20Br2N2O |
| Molecular Weight | 368.11 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine |
| SMILES | CCC(C)(C)N(C)C(CN)c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C12H20Br2N2O/c1-5-12(2,3)16(4)9(7-15)10-6-8(13)11(14)17-10/h6,9H,5,7,15H2,1-4H3 |
| InChIKey | FDNMDDKXCCLEJA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.11 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine?
The IUPAC name of 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine (CID 63982675) is 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine?
The canonical SMILES for 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine is CCC(C)(C)N(C)C(CN)c1cc(Br)c(Br)o1.
What is the InChIKey of 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine?
The InChIKey is FDNMDDKXCCLEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20Br2N2O/c1-5-12(2,3)16(4)9(7-15)10-6-8(13)11(14)17-10/h6,9H,5,7,15H2,1-4H3.
What are the key properties of 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine?
1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine has a molecular weight of 368.11 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(2-methylbutan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 63982675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).