About 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine
1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine (PubChem CID 62085568) has the molecular formula C13H21Br2N3O
and a molecular weight of 395.14 g/mol. Its IUPAC name is 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine |
| PubChem CID | 62085568 |
| Molecular Formula | C13H21Br2N3O |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine |
| SMILES | CN1CCC(N(C)C(CN)c2cc(Br)c(Br)o2)CC1 |
| InChI | InChI=1S/C13H21Br2N3O/c1-17-5-3-9(4-6-17)18(2)11(8-16)12-7-10(14)13(15)19-12/h7,9,11H,3-6,8,16H2,1-2H3 |
| InChIKey | WELNLLOWXKNQHJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine?
The IUPAC name of 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine (CID 62085568) is 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine?
The canonical SMILES for 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine is CN1CCC(N(C)C(CN)c2cc(Br)c(Br)o2)CC1.
What is the InChIKey of 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine?
The InChIKey is WELNLLOWXKNQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21Br2N3O/c1-17-5-3-9(4-6-17)18(2)11(8-16)12-7-10(14)13(15)19-12/h7,9,11H,3-6,8,16H2,1-2H3.
What are the key properties of 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine?
1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine has a molecular weight of 395.14 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dibromofuran-2-yl)-N-methyl-N-(1-methylpiperidin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 62085568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).