C10H16Br2N2O — CID 62084855
1-(4,5-dibromofuran-2-yl)-N,N-diethylethane-1,2-diamine (PubChem CID 62084855) has the molecular formula C10H16Br2N2O and a molecular weight of 340.06 g/mol. Its IUPAC name is 1-(4,5-dibromofuran-2-yl)-N,N-diethylethane-1,2-diamine.
| Compound Name | 1-(4,5-dibromofuran-2-yl)-N,N-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 62084855 |
| Molecular Formula | C10H16Br2N2O |
| Molecular Weight | 340.06 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 1-(4,5-dibromofuran-2-yl)-N,N-diethylethane-1,2-diamine |
| SMILES | CCN(CC)C(CN)c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C10H16Br2N2O/c1-3-14(4-2)8(6-13)9-5-7(11)10(12)15-9/h5,8H,3-4,6,13H2,1-2H3 |
| InChIKey | NUNNPXBLUQVPEO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.06 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |