C15H25N3O2 — CID 16789742
4-[2-amino-1-[methyl-(1-methylpiperidin-4-yl)amino]ethyl]benzene-1,2-diol (PubChem CID 16789742) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-[2-amino-1-[methyl-(1-methylpiperidin-4-yl)amino]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-amino-1-[methyl-(1-methylpiperidin-4-yl)amino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 16789742 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 4-[2-amino-1-[methyl-(1-methylpiperidin-4-yl)amino]ethyl]benzene-1,2-diol |
| SMILES | CN1CCC(N(C)C(CN)c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C15H25N3O2/c1-17-7-5-12(6-8-17)18(2)13(10-16)11-3-4-14(19)15(20)9-11/h3-4,9,12-13,19-20H,5-8,10,16H2,1-2H3 |
| InChIKey | IWKUOBSBAHXGIY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|