C17H24N2O2 — CID 63985003
2-cyclopropyl-3-[3-(methoxymethyl)phenoxy]-2-(propan-2-ylamino)propanenitrile (PubChem CID 63985003) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-cyclopropyl-3-[3-(methoxymethyl)phenoxy]-2-(propan-2-ylamino)propanenitrile.
| Compound Name | 2-cyclopropyl-3-[3-(methoxymethyl)phenoxy]-2-(propan-2-ylamino)propanenitrile |
|---|---|
| PubChem CID | 63985003 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-cyclopropyl-3-[3-(methoxymethyl)phenoxy]-2-(propan-2-ylamino)propanenitrile |
| SMILES | COCc1cccc(OCC(C#N)(NC(C)C)C2CC2)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-13(2)19-17(11-18,15-7-8-15)12-21-16-6-4-5-14(9-16)10-20-3/h4-6,9,13,15,19H,7-8,10,12H2,1-3H3 |
| InChIKey | IJUMZLGWBLCCHR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |