C14H16BrN3O — CID 63987280
2-(5-bromo-2-methoxyphenyl)-N-methyl-1-pyrimidin-4-ylethanamine (PubChem CID 63987280) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-N-methyl-1-pyrimidin-4-ylethanamine.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-N-methyl-1-pyrimidin-4-ylethanamine |
|---|---|
| PubChem CID | 63987280 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-N-methyl-1-pyrimidin-4-ylethanamine |
| SMILES | CNC(Cc1cc(Br)ccc1OC)c1ccncn1 |
| InChI | InChI=1S/C14H16BrN3O/c1-16-13(12-5-6-17-9-18-12)8-10-7-11(15)3-4-14(10)19-2/h3-7,9,13,16H,8H2,1-2H3 |
| InChIKey | IXPRPTMNLXPDFI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |