C14H17BrN4O2 — CID 102953300
[2-(5-bromo-2-methoxyphenyl)-1-(6-methoxypyrimidin-4-yl)ethyl]hydrazine (PubChem CID 102953300) has the molecular formula C14H17BrN4O2 and a molecular weight of 353.22 g/mol. Its IUPAC name is [2-(5-bromo-2-methoxyphenyl)-1-(6-methoxypyrimidin-4-yl)ethyl]hydrazine.
| Compound Name | [2-(5-bromo-2-methoxyphenyl)-1-(6-methoxypyrimidin-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102953300 |
| Molecular Formula | C14H17BrN4O2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | [2-(5-bromo-2-methoxyphenyl)-1-(6-methoxypyrimidin-4-yl)ethyl]hydrazine |
| SMILES | COc1cc(C(Cc2cc(Br)ccc2OC)NN)ncn1 |
| InChI | InChI=1S/C14H17BrN4O2/c1-20-13-4-3-10(15)5-9(13)6-12(19-16)11-7-14(21-2)18-8-17-11/h3-5,7-8,12,19H,6,16H2,1-2H3 |
| InChIKey | JIQMODATKQDAPN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|