C12H15N3S — CID 63988342
N-ethyl-1-pyrimidin-4-yl-2-thiophen-2-ylethanamine (PubChem CID 63988342) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-ethyl-1-pyrimidin-4-yl-2-thiophen-2-ylethanamine.
| Compound Name | N-ethyl-1-pyrimidin-4-yl-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 63988342 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-ethyl-1-pyrimidin-4-yl-2-thiophen-2-ylethanamine |
| SMILES | CCNC(Cc1cccs1)c1ccncn1 |
| InChI | InChI=1S/C12H15N3S/c1-2-14-12(8-10-4-3-7-16-10)11-5-6-13-9-15-11/h3-7,9,12,14H,2,8H2,1H3 |
| InChIKey | QBFUMNQLHQIGLI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |