C10H21NO2 — CID 63989699
1-cyclopropyl-N-(2,2-dimethoxyethyl)propan-2-amine (PubChem CID 63989699) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 1-cyclopropyl-N-(2,2-dimethoxyethyl)propan-2-amine.
| Compound Name | 1-cyclopropyl-N-(2,2-dimethoxyethyl)propan-2-amine |
|---|---|
| PubChem CID | 63989699 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 1-cyclopropyl-N-(2,2-dimethoxyethyl)propan-2-amine |
| SMILES | COC(CNC(C)CC1CC1)OC |
| InChI | InChI=1S/C10H21NO2/c1-8(6-9-4-5-9)11-7-10(12-2)13-3/h8-11H,4-7H2,1-3H3 |
| InChIKey | IFYHZTXLXQCQLG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|