C9H6N4S — CID 63989817
2-(2-pyrimidin-4-yl-1,3-thiazol-4-yl)acetonitrile (PubChem CID 63989817) has the molecular formula C9H6N4S and a molecular weight of 202.24 g/mol. Its IUPAC name is 2-(2-pyrimidin-4-yl-1,3-thiazol-4-yl)acetonitrile.
| Compound Name | 2-(2-pyrimidin-4-yl-1,3-thiazol-4-yl)acetonitrile |
|---|---|
| PubChem CID | 63989817 |
| Molecular Formula | C9H6N4S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2-(2-pyrimidin-4-yl-1,3-thiazol-4-yl)acetonitrile |
| SMILES | N#CCc1csc(-c2ccncn2)n1 |
| InChI | InChI=1S/C9H6N4S/c10-3-1-7-5-14-9(13-7)8-2-4-11-6-12-8/h2,4-6H,1H2 |
| InChIKey | IPFJUHGSHZHDIU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |