C14H15F2NO2S2 — CID 63991471
2-(difluoromethylsulfonyl)-N-[1-(3-methylthiophen-2-yl)ethyl]aniline (PubChem CID 63991471) has the molecular formula C14H15F2NO2S2 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-[1-(3-methylthiophen-2-yl)ethyl]aniline.
| Compound Name | 2-(difluoromethylsulfonyl)-N-[1-(3-methylthiophen-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 63991471 |
| Molecular Formula | C14H15F2NO2S2 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-[1-(3-methylthiophen-2-yl)ethyl]aniline |
| SMILES | Cc1ccsc1C(C)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C14H15F2NO2S2/c1-9-7-8-20-13(9)10(2)17-11-5-3-4-6-12(11)21(18,19)14(15)16/h3-8,10,14,17H,1-2H3 |
| InChIKey | GVLQXZGLHUERJU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |