C14H23N3O2S — CID 63995589
N-(1-cyclopropylpropan-2-yl)-2-(propylamino)pyridine-4-sulfonamide (PubChem CID 63995589) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-(1-cyclopropylpropan-2-yl)-2-(propylamino)pyridine-4-sulfonamide.
| Compound Name | N-(1-cyclopropylpropan-2-yl)-2-(propylamino)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 63995589 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(1-cyclopropylpropan-2-yl)-2-(propylamino)pyridine-4-sulfonamide |
| SMILES | CCCNc1cc(S(=O)(=O)NC(C)CC2CC2)ccn1 |
| InChI | InChI=1S/C14H23N3O2S/c1-3-7-15-14-10-13(6-8-16-14)20(18,19)17-11(2)9-12-4-5-12/h6,8,10-12,17H,3-5,7,9H2,1-2H3,(H,15,16) |
| InChIKey | REZJARIMWFVTAZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |