C13H20N4O3S — CID 62146358
N-(2-oxopiperidin-3-yl)-2-(propylamino)pyridine-4-sulfonamide (PubChem CID 62146358) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is N-(2-oxopiperidin-3-yl)-2-(propylamino)pyridine-4-sulfonamide.
| Compound Name | N-(2-oxopiperidin-3-yl)-2-(propylamino)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 62146358 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-(2-oxopiperidin-3-yl)-2-(propylamino)pyridine-4-sulfonamide |
| SMILES | CCCNc1cc(S(=O)(=O)NC2CCCNC2=O)ccn1 |
| InChI | InChI=1S/C13H20N4O3S/c1-2-6-14-12-9-10(5-8-15-12)21(19,20)17-11-4-3-7-16-13(11)18/h5,8-9,11,17H,2-4,6-7H2,1H3,(H,14,15)(H,16,18) |
| InChIKey | WCGUTIHYJNJGKJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |