C15H21NO — CID 63997272
N-[1-(2-methoxyphenyl)propyl]-2-methylbut-3-yn-2-amine (PubChem CID 63997272) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[1-(2-methoxyphenyl)propyl]-2-methylbut-3-yn-2-amine.
| Compound Name | N-[1-(2-methoxyphenyl)propyl]-2-methylbut-3-yn-2-amine |
|---|---|
| PubChem CID | 63997272 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-[1-(2-methoxyphenyl)propyl]-2-methylbut-3-yn-2-amine |
| SMILES | C#CC(C)(C)NC(CC)c1ccccc1OC |
| InChI | InChI=1S/C15H21NO/c1-6-13(16-15(3,4)7-2)12-10-8-9-11-14(12)17-5/h2,8-11,13,16H,6H2,1,3-5H3 |
| InChIKey | AWWRWXNGEDZJOE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|