C13H11NO2S — CID 640044
6-methylbenzo[c][1,2]benzothiazine 5,5-dioxide (PubChem CID 640044) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 6-methylbenzo[c][1,2]benzothiazine 5,5-dioxide.
| Compound Name | 6-methylbenzo[c][1,2]benzothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 640044 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 6-methylbenzo[c][1,2]benzothiazine 5,5-dioxide |
| SMILES | CN1c2ccccc2-c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C13H11NO2S/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)17(14,15)16/h2-9H,1H3 |
| InChIKey | SNZIZHFNRMQFOQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |