C15H14ClNO2S — CID 2843275
1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 2843275) has the molecular formula C15H14ClNO2S and a molecular weight of 307.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 2843275 |
| Molecular Formula | C15H14ClNO2S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C15H14ClNO2S/c16-13-7-9-14(10-8-13)20(18,19)17-11-3-5-12-4-1-2-6-15(12)17/h1-2,4,6-10H,3,5,11H2 |
| InChIKey | RMRCIUGTXUYGNZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |