C20H18N4 — CID 6401162
1-(3,5-dimethylpyrazol-1-yl)-4-(4-methylphenyl)phthalazine (PubChem CID 6401162) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazol-1-yl)-4-(4-methylphenyl)phthalazine.
| Compound Name | 1-(3,5-dimethylpyrazol-1-yl)-4-(4-methylphenyl)phthalazine |
|---|---|
| PubChem CID | 6401162 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-(3,5-dimethylpyrazol-1-yl)-4-(4-methylphenyl)phthalazine |
| SMILES | Cc1ccc(-c2nnc(-n3nc(C)cc3C)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H18N4/c1-13-8-10-16(11-9-13)19-17-6-4-5-7-18(17)20(22-21-19)24-15(3)12-14(2)23-24/h4-12H,1-3H3 |
| InChIKey | VCJFLOUIZAJBAA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |