About bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene
bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene (PubChem CID 12718144) has the molecular formula C22H22N6
and a molecular weight of 370.46 g/mol. Its IUPAC name is bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene.
Molecular Properties
| Compound Name | bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene |
| PubChem CID | 12718144 |
| Molecular Formula | C22H22N6 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene |
| SMILES | Cc1cc(C)n(-c2ccccc2/N=N/c2ccccc2-n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C22H22N6/c1-15-13-17(3)27(25-15)21-11-7-5-9-19(21)23-24-20-10-6-8-12-22(20)28-18(4)14-16(2)26-28/h5-14H,1-4H3/b24-23+ |
| InChIKey | UQIPTJPZOVZBSB-WCWDXBQESA-N |
| XLogP | 5.71 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene?
The IUPAC name of bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene (CID 12718144) is bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene.
What is the SMILES notation for bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene?
The canonical SMILES for bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene is Cc1cc(C)n(-c2ccccc2/N=N/c2ccccc2-n2nc(C)cc2C)n1.
What is the InChIKey of bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene?
The InChIKey is UQIPTJPZOVZBSB-WCWDXBQESA-N. The full InChI is InChI=1S/C22H22N6/c1-15-13-17(3)27(25-15)21-11-7-5-9-19(21)23-24-20-10-6-8-12-22(20)28-18(4)14-16(2)26-28/h5-14H,1-4H3/b24-23+.
What are the key properties of bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene?
bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene has a molecular weight of 370.46 g/mol, XLogP of 5.71, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(3,5-dimethylpyrazol-1-yl)phenyl]diazene is sourced from PubChem (CID 12718144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).