C12H14N2O — CID 12746736
[2-(3,5-dimethylpyrazol-1-yl)phenyl]methanol (PubChem CID 12746736) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is [2-(3,5-dimethylpyrazol-1-yl)phenyl]methanol.
| Compound Name | [2-(3,5-dimethylpyrazol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 12746736 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | [2-(3,5-dimethylpyrazol-1-yl)phenyl]methanol |
| SMILES | Cc1cc(C)n(-c2ccccc2CO)n1 |
| InChI | InChI=1S/C12H14N2O/c1-9-7-10(2)14(13-9)12-6-4-3-5-11(12)8-15/h3-7,15H,8H2,1-2H3 |
| InChIKey | AEIOISZNLJGTIS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |