C17H19F4N3O — CID 167792453
N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-3,3,4,4-tetrafluoro-2-methylbutanamide (PubChem CID 167792453) has the molecular formula C17H19F4N3O and a molecular weight of 357.35 g/mol. Its IUPAC name is N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-3,3,4,4-tetrafluoro-2-methylbutanamide.
| Compound Name | N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-3,3,4,4-tetrafluoro-2-methylbutanamide |
|---|---|
| PubChem CID | 167792453 |
| Molecular Formula | C17H19F4N3O |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-3,3,4,4-tetrafluoro-2-methylbutanamide |
| SMILES | Cc1cc(C)n(-c2ccccc2CNC(=O)C(C)C(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C17H19F4N3O/c1-10-8-11(2)24(23-10)14-7-5-4-6-13(14)9-22-15(25)12(3)17(20,21)16(18)19/h4-8,12,16H,9H2,1-3H3,(H,22,25) |
| InChIKey | SJDLUUVPNQPQGR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|