C16H16ClF4N3O3 — CID 166427563
2-chloro-N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-2-fluoroacetamide;2,2,2-trifluoroacetic acid (PubChem CID 166427563) has the molecular formula C16H16ClF4N3O3 and a molecular weight of 409.77 g/mol. Its IUPAC name is 2-chloro-N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-2-fluoroacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-chloro-N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-2-fluoroacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166427563 |
| Molecular Formula | C16H16ClF4N3O3 |
| Molecular Weight | 409.77 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-chloro-N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-2-fluoroacetamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)n(-c2ccccc2CNC(=O)C(F)Cl)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H15ClFN3O.C2HF3O2/c1-9-7-10(2)19(18-9)12-6-4-3-5-11(12)8-17-14(20)13(15)16;3-2(4,5)1(6)7/h3-7,13H,8H2,1-2H3,(H,17,20);(H,6,7) |
| InChIKey | ZIIOHYVWFMWHDS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|