C17H22F3N5 — CID 109471567
1-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109471567) has the molecular formula C17H22F3N5 and a molecular weight of 353.39 g/mol. Its IUPAC name is 1-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109471567 |
| Molecular Formula | C17H22F3N5 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccccc1-n1nc(C)cc1C |
| InChI | InChI=1S/C17H22F3N5/c1-12-10-13(2)25(24-12)15-7-5-4-6-14(15)11-23-16(21-3)22-9-8-17(18,19)20/h4-7,10H,8-9,11H2,1-3H3,(H2,21,22,23) |
| InChIKey | DOKCRVXXLZXVDW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|