C22H26N6O — CID 109451671
3-[[[N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 109451671) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 3-[[[N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | 3-[[[N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109451671 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 3-[[[N-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1cccc(C(N)=O)c1)NCc1ccccc1-n1nc(C)cc1C |
| InChI | InChI=1S/C22H26N6O/c1-15-11-16(2)28(27-15)20-10-5-4-8-19(20)14-26-22(24-3)25-13-17-7-6-9-18(12-17)21(23)29/h4-12H,13-14H2,1-3H3,(H2,23,29)(H2,24,25,26) |
| InChIKey | DWKZKXWEFGTEJD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|