C10H14N3O2+ — CID 6401318
(2Z)-2-hydroxyimino-N-[(1-methylpyridin-1-ium-3-yl)methyl]propanamide (PubChem CID 6401318) has the molecular formula C10H14N3O2+ and a molecular weight of 208.24 g/mol. Its IUPAC name is (2Z)-2-hydroxyimino-N-[(1-methylpyridin-1-ium-3-yl)methyl]propanamide.
| Compound Name | (2Z)-2-hydroxyimino-N-[(1-methylpyridin-1-ium-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 6401318 |
| Molecular Formula | C10H14N3O2+ |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2Z)-2-hydroxyimino-N-[(1-methylpyridin-1-ium-3-yl)methyl]propanamide |
| SMILES | C/C(=N/O)C(=O)NCc1ccc[n+](C)c1 |
| InChI | InChI=1S/C10H13N3O2/c1-8(12-15)10(14)11-6-9-4-3-5-13(2)7-9/h3-5,7H,6H2,1-2H3,(H-,11,14,15)/p+1 |
| InChIKey | IPKVYPQYMUBRKE-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 65.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|