C18H17N3O4 — CID 20981911
methyl 4-[3-(benzylamino)-2,3-dioxopropanehydrazonoyl]benzoate (PubChem CID 20981911) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl 4-[3-(benzylamino)-2,3-dioxopropanehydrazonoyl]benzoate.
| Compound Name | methyl 4-[3-(benzylamino)-2,3-dioxopropanehydrazonoyl]benzoate |
|---|---|
| PubChem CID | 20981911 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | methyl 4-[3-(benzylamino)-2,3-dioxopropanehydrazonoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=NN)C(=O)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N3O4/c1-25-18(24)14-9-7-13(8-10-14)15(21-19)16(22)17(23)20-11-12-5-3-2-4-6-12/h2-10H,11,19H2,1H3,(H,20,23) |
| InChIKey | AYKYWHKQVCPRMB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|