About 4-phenylpyridazine
4-phenylpyridazine (PubChem CID 6401329) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 4-phenylpyridazine.
Molecular Properties
| Compound Name | 4-phenylpyridazine |
| PubChem CID | 6401329 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 4-phenylpyridazine |
| SMILES | c1ccc(-c2ccnnc2)cc1 |
| InChI | InChI=1S/C10H8N2/c1-2-4-9(5-3-1)10-6-7-11-12-8-10/h1-8H |
| InChIKey | VYPDRJDYVPYUJY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpyridazine?
The IUPAC name of 4-phenylpyridazine (CID 6401329) is 4-phenylpyridazine.
What is the SMILES notation for 4-phenylpyridazine?
The canonical SMILES for 4-phenylpyridazine is c1ccc(-c2ccnnc2)cc1.
What is the InChIKey of 4-phenylpyridazine?
The InChIKey is VYPDRJDYVPYUJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-4-9(5-3-1)10-6-7-11-12-8-10/h1-8H.
What are the key properties of 4-phenylpyridazine?
4-phenylpyridazine has a molecular weight of 156.19 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpyridazine is sourced from PubChem (CID 6401329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).