C18H16N4 — CID 6403503
1-(5,6-dimethylbenzimidazol-1-yl)-4-methylphthalazine (PubChem CID 6403503) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(5,6-dimethylbenzimidazol-1-yl)-4-methylphthalazine.
| Compound Name | 1-(5,6-dimethylbenzimidazol-1-yl)-4-methylphthalazine |
|---|---|
| PubChem CID | 6403503 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-(5,6-dimethylbenzimidazol-1-yl)-4-methylphthalazine |
| SMILES | Cc1cc2ncn(-c3nnc(C)c4ccccc34)c2cc1C |
| InChI | InChI=1S/C18H16N4/c1-11-8-16-17(9-12(11)2)22(10-19-16)18-15-7-5-4-6-14(15)13(3)20-21-18/h4-10H,1-3H3 |
| InChIKey | XVTCOVYYXPRKOR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |