C20H25N5OS — CID 6404375
1-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-[(5,8-dimethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone (PubChem CID 6404375) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-[(5,8-dimethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-[(5,8-dimethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 6404375 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-[(5,8-dimethyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]ethanone |
| SMILES | Cc1ccc2c(c1)c1nnc(SCC(=O)N3[C@H](C)CCC[C@H]3C)nc1n2C |
| InChI | InChI=1S/C20H25N5OS/c1-12-8-9-16-15(10-12)18-19(24(16)4)21-20(23-22-18)27-11-17(26)25-13(2)6-5-7-14(25)3/h8-10,13-14H,5-7,11H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | XXNRTGYADRPQFJ-ZIAGYGMSSA-N |
| XLogP | 3.71 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |