C15H10ClFN4 — CID 6405105
6-(4-chlorophenyl)-3-(2-fluorophenyl)-1,2,4-triazin-5-amine (PubChem CID 6405105) has the molecular formula C15H10ClFN4 and a molecular weight of 300.72 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-(2-fluorophenyl)-1,2,4-triazin-5-amine.
| Compound Name | 6-(4-chlorophenyl)-3-(2-fluorophenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 6405105 |
| Molecular Formula | C15H10ClFN4 |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 6-(4-chlorophenyl)-3-(2-fluorophenyl)-1,2,4-triazin-5-amine |
| SMILES | Nc1nc(-c2ccccc2F)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClFN4/c16-10-7-5-9(6-8-10)13-14(18)19-15(21-20-13)11-3-1-2-4-12(11)17/h1-8H,(H2,18,19,21) |
| InChIKey | FKGZWTPCKMEBHS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |