C20H21N7O4S — CID 6405506
N-[3-(3-methoxypropyl)-2,6-dioxopyrimidin-4-yl]-2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide (PubChem CID 6405506) has the molecular formula C20H21N7O4S and a molecular weight of 455.50 g/mol. Its IUPAC name is N-[3-(3-methoxypropyl)-2,6-dioxopyrimidin-4-yl]-2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[3-(3-methoxypropyl)-2,6-dioxopyrimidin-4-yl]-2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6405506 |
| Molecular Formula | C20H21N7O4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-[3-(3-methoxypropyl)-2,6-dioxopyrimidin-4-yl]-2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetamide |
| SMILES | COCCCn1c(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C20H21N7O4S/c1-26-13-7-4-3-6-12(13)17-18(26)23-19(25-24-17)32-11-16(29)21-14-10-15(28)22-20(30)27(14)8-5-9-31-2/h3-4,6-7,10H,5,8-9,11H2,1-2H3,(H,21,29)(H,22,28,30) |
| InChIKey | GRDGSMUCHLYEHV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|