C23H24N4O2S — CID 6405872
(6R)-6-(2-butoxyphenyl)-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6405872) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is (6R)-6-(2-butoxyphenyl)-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-6-(2-butoxyphenyl)-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6405872 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (6R)-6-(2-butoxyphenyl)-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | C=CCSc1nnc2c(n1)O[C@H](c1ccccc1OCCCC)Nc1ccccc1-2 |
| InChI | InChI=1S/C23H24N4O2S/c1-3-5-14-28-19-13-9-7-11-17(19)21-24-18-12-8-6-10-16(18)20-22(29-21)25-23(27-26-20)30-15-4-2/h4,6-13,21,24H,2-3,5,14-15H2,1H3/t21-/m1/s1 |
| InChIKey | HABPTJFAOQWHCA-OAQYLSRUSA-N |
| XLogP | 5.50 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|