C29H36N4O3S — CID 6406188
1-[(6R)-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-propylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 6406188) has the molecular formula C29H36N4O3S and a molecular weight of 520.70 g/mol. Its IUPAC name is 1-[(6R)-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-propylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6R)-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-propylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 6406188 |
| Molecular Formula | C29H36N4O3S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 1-[(6R)-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-propylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCSc1nnc2c(n1)O[C@H](c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C29H36N4O3S/c1-9-14-37-27-30-25-23(31-32-27)19-12-10-11-13-22(19)33(17(2)34)26(36-25)18-15-20(28(3,4)5)24(35)21(16-18)29(6,7)8/h10-13,15-16,26,35H,9,14H2,1-8H3/t26-/m1/s1 |
| InChIKey | KKJZLFSEDCKZAC-AREMUKBSSA-N |
| XLogP | 6.79 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |