C23H20N4O4S — CID 6406628
[2-[(6R)-7-acetyl-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenyl] acetate (PubChem CID 6406628) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is [2-[(6R)-7-acetyl-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenyl] acetate.
| Compound Name | [2-[(6R)-7-acetyl-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenyl] acetate |
|---|---|
| PubChem CID | 6406628 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [2-[(6R)-7-acetyl-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenyl] acetate |
| SMILES | C=CCSc1nnc2c(n1)O[C@H](c1ccccc1OC(C)=O)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H20N4O4S/c1-4-13-32-23-24-21-20(25-26-23)16-9-5-7-11-18(16)27(14(2)28)22(31-21)17-10-6-8-12-19(17)30-15(3)29/h4-12,22H,1,13H2,2-3H3/t22-/m1/s1 |
| InChIKey | YLTWIQYJOPTYBZ-JOCHJYFZSA-N |
| XLogP | 4.19 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|