C22H19BrN4O3S — CID 6406756
[4-[(6R)-10-bromo-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenyl] propanoate (PubChem CID 6406756) has the molecular formula C22H19BrN4O3S and a molecular weight of 499.39 g/mol. Its IUPAC name is [4-[(6R)-10-bromo-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenyl] propanoate.
| Compound Name | [4-[(6R)-10-bromo-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 6406756 |
| Molecular Formula | C22H19BrN4O3S |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | [4-[(6R)-10-bromo-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenyl] propanoate |
| SMILES | C=CCSc1nnc2c(n1)O[C@H](c1ccc(OC(=O)CC)cc1)Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C22H19BrN4O3S/c1-3-11-31-22-25-21-19(26-27-22)16-12-14(23)7-10-17(16)24-20(30-21)13-5-8-15(9-6-13)29-18(28)4-2/h3,5-10,12,20,24H,1,4,11H2,2H3/t20-/m1/s1 |
| InChIKey | KOXIRLKMSIQOAW-HXUWFJFHSA-N |
| XLogP | 5.40 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|