C23H18N4OS — CID 6407249
N-(2-phenylethyl)-2-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)acetamide (PubChem CID 6407249) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)acetamide.
| Compound Name | N-(2-phenylethyl)-2-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 6407249 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-(2-phenylethyl)-2-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2c(n1)-c1cccc3cccc-2c13)NCCc1ccccc1 |
| InChI | InChI=1S/C23H18N4OS/c28-19(24-13-12-15-6-2-1-3-7-15)14-29-23-25-21-17-10-4-8-16-9-5-11-18(20(16)17)22(21)26-27-23/h1-11H,12-14H2,(H,24,28) |
| InChIKey | LPPOJAHBKDHKJL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |