C21H14Cl2N4O2S — CID 6408165
(6R)-6-[5-(2,4-dichlorophenyl)furan-2-yl]-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 6408165) has the molecular formula C21H14Cl2N4O2S and a molecular weight of 457.34 g/mol. Its IUPAC name is (6R)-6-[5-(2,4-dichlorophenyl)furan-2-yl]-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-6-[5-(2,4-dichlorophenyl)furan-2-yl]-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 6408165 |
| Molecular Formula | C21H14Cl2N4O2S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | (6R)-6-[5-(2,4-dichlorophenyl)furan-2-yl]-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CSc1nnc2c(n1)O[C@H](c1ccc(-c3ccc(Cl)cc3Cl)o1)Nc1ccccc1-2 |
| InChI | InChI=1S/C21H14Cl2N4O2S/c1-30-21-25-20-18(26-27-21)13-4-2-3-5-15(13)24-19(29-20)17-9-8-16(28-17)12-7-6-11(22)10-14(12)23/h2-10,19,24H,1H3/t19-/m1/s1 |
| InChIKey | MMHGMBXFPMTMAW-LJQANCHMSA-N |
| XLogP | 6.33 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |