C26H25ClN4O2S — CID 26366148
(6R)-6-[5-(2-chlorophenyl)furan-2-yl]-3-hexylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 26366148) has the molecular formula C26H25ClN4O2S and a molecular weight of 493.03 g/mol. Its IUPAC name is (6R)-6-[5-(2-chlorophenyl)furan-2-yl]-3-hexylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-6-[5-(2-chlorophenyl)furan-2-yl]-3-hexylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 26366148 |
| Molecular Formula | C26H25ClN4O2S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | (6R)-6-[5-(2-chlorophenyl)furan-2-yl]-3-hexylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCCCSc1nnc2c(n1)O[C@H](c1ccc(-c3ccccc3Cl)o1)Nc1ccccc1-2 |
| InChI | InChI=1S/C26H25ClN4O2S/c1-2-3-4-9-16-34-26-29-25-23(30-31-26)18-11-6-8-13-20(18)28-24(33-25)22-15-14-21(32-22)17-10-5-7-12-19(17)27/h5-8,10-15,24,28H,2-4,9,16H2,1H3/t24-/m1/s1 |
| InChIKey | IXCVIXGJHGHIIU-XMMPIXPASA-N |
| XLogP | 7.63 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|