C25H31N5OS — CID 6405984
N,N-diethyl-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline (PubChem CID 6405984) has the molecular formula C25H31N5OS and a molecular weight of 449.62 g/mol. Its IUPAC name is N,N-diethyl-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline.
| Compound Name | N,N-diethyl-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline |
|---|---|
| PubChem CID | 6405984 |
| Molecular Formula | C25H31N5OS |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N,N-diethyl-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline |
| SMILES | CCCCCSc1nnc2c(n1)O[C@H](c1ccc(N(CC)CC)cc1)Nc1ccccc1-2 |
| InChI | InChI=1S/C25H31N5OS/c1-4-7-10-17-32-25-27-24-22(28-29-25)20-11-8-9-12-21(20)26-23(31-24)18-13-15-19(16-14-18)30(5-2)6-3/h8-9,11-16,23,26H,4-7,10,17H2,1-3H3/t23-/m1/s1 |
| InChIKey | UOTONDINSBJZLF-HSZRJFAPSA-N |
| XLogP | 6.17 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|