C23H24N4O3S — CID 6405894
4-[(6R)-3-hexylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzoic acid (PubChem CID 6405894) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 4-[(6R)-3-hexylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzoic acid.
| Compound Name | 4-[(6R)-3-hexylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 6405894 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-[(6R)-3-hexylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzoic acid |
| SMILES | CCCCCCSc1nnc2c(n1)O[C@H](c1ccc(C(=O)O)cc1)Nc1ccccc1-2 |
| InChI | InChI=1S/C23H24N4O3S/c1-2-3-4-7-14-31-23-25-21-19(26-27-23)17-8-5-6-9-18(17)24-20(30-21)15-10-12-16(13-11-15)22(28)29/h5-6,8-13,20,24H,2-4,7,14H2,1H3,(H,28,29)/t20-/m1/s1 |
| InChIKey | ZYFZHCMGTFQTOE-HXUWFJFHSA-N |
| XLogP | 5.41 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|