C24H26N4O3S — CID 22331340
6-(1,3-benzodioxol-5-yl)-3-heptylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 22331340) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-3-heptylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-3-heptylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 22331340 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-3-heptylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCCCCSc1nnc2c(n1)OC(c1ccc3c(c1)OCO3)Nc1ccccc1-2 |
| InChI | InChI=1S/C24H26N4O3S/c1-2-3-4-5-8-13-32-24-26-23-21(27-28-24)17-9-6-7-10-18(17)25-22(31-23)16-11-12-19-20(14-16)30-15-29-19/h6-7,9-12,14,22,25H,2-5,8,13,15H2,1H3 |
| InChIKey | JUZWQXKVPSFTSF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|