C23H24N4O4S — CID 26366965
(6R)-6-(7-methoxy-1,3-benzodioxol-5-yl)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 26366965) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is (6R)-6-(7-methoxy-1,3-benzodioxol-5-yl)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-6-(7-methoxy-1,3-benzodioxol-5-yl)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 26366965 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (6R)-6-(7-methoxy-1,3-benzodioxol-5-yl)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCCCSc1nnc2c(n1)O[C@H](c1cc(OC)c3c(c1)OCO3)Nc1ccccc1-2 |
| InChI | InChI=1S/C23H24N4O4S/c1-3-4-7-10-32-23-25-22-19(26-27-23)15-8-5-6-9-16(15)24-21(31-22)14-11-17(28-2)20-18(12-14)29-13-30-20/h5-6,8-9,11-12,21,24H,3-4,7,10,13H2,1-2H3/t21-/m1/s1 |
| InChIKey | JRYHFZUCVBUQQI-OAQYLSRUSA-N |
| XLogP | 5.06 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|