C21H20N4O4S — CID 2961711
6-(7-methoxy-1,3-benzodioxol-5-yl)-3-propylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 2961711) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is 6-(7-methoxy-1,3-benzodioxol-5-yl)-3-propylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(7-methoxy-1,3-benzodioxol-5-yl)-3-propylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 2961711 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 6-(7-methoxy-1,3-benzodioxol-5-yl)-3-propylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CCCSc1nnc2c(n1)OC(c1cc(OC)c3c(c1)OCO3)Nc1ccccc1-2 |
| InChI | InChI=1S/C21H20N4O4S/c1-3-8-30-21-23-20-17(24-25-21)13-6-4-5-7-14(13)22-19(29-20)12-9-15(26-2)18-16(10-12)27-11-28-18/h4-7,9-10,19,22H,3,8,11H2,1-2H3 |
| InChIKey | SYZXLFKWEPQCHQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |