C23H25ClN4O3S — CID 6412603
2-chloro-6-ethoxy-4-(3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol (PubChem CID 6412603) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is 2-chloro-6-ethoxy-4-(3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol.
| Compound Name | 2-chloro-6-ethoxy-4-(3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol |
|---|---|
| PubChem CID | 6412603 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-chloro-6-ethoxy-4-(3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol |
| SMILES | CCCCCSc1nnc2c(n1)OC(c1cc(Cl)c(O)c(OCC)c1)Nc1ccccc1-2 |
| InChI | InChI=1S/C23H25ClN4O3S/c1-3-5-8-11-32-23-26-22-19(27-28-23)15-9-6-7-10-17(15)25-21(31-22)14-12-16(24)20(29)18(13-14)30-4-2/h6-7,9-10,12-13,21,25,29H,3-5,8,11H2,1-2H3 |
| InChIKey | QCCWVKAVMVDJAB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|