C26H29BrN4O3S — CID 7027287
(6R)-6-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 7027287) has the molecular formula C26H29BrN4O3S and a molecular weight of 557.51 g/mol. Its IUPAC name is (6R)-6-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | (6R)-6-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 7027287 |
| Molecular Formula | C26H29BrN4O3S |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | (6R)-6-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | C=CCOc1c(Br)cc([C@@H]2Nc3ccccc3-c3nnc(SCCCCC)nc3O2)cc1OCC |
| InChI | InChI=1S/C26H29BrN4O3S/c1-4-7-10-14-35-26-29-25-22(30-31-26)18-11-8-9-12-20(18)28-24(34-25)17-15-19(27)23(33-13-5-2)21(16-17)32-6-3/h5,8-9,11-12,15-16,24,28H,2,4,6-7,10,13-14H2,1,3H3/t24-/m1/s1 |
| InChIKey | YWSFGFHYBJTRDE-XMMPIXPASA-N |
| XLogP | 7.05 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|