C23H25N5O5S — CID 6418386
2-ethoxy-6-nitro-4-(3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol (PubChem CID 6418386) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-ethoxy-6-nitro-4-(3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol.
| Compound Name | 2-ethoxy-6-nitro-4-(3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol |
|---|---|
| PubChem CID | 6418386 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-ethoxy-6-nitro-4-(3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol |
| SMILES | CCCCCSc1nnc2c(n1)OC(c1cc(OCC)c(O)c([N+](=O)[O-])c1)Nc1ccccc1-2 |
| InChI | InChI=1S/C23H25N5O5S/c1-3-5-8-11-34-23-25-22-19(26-27-23)15-9-6-7-10-16(15)24-21(33-22)14-12-17(28(30)31)20(29)18(13-14)32-4-2/h6-7,9-10,12-13,21,24,29H,3-5,8,11H2,1-2H3 |
| InChIKey | HZOSWSLKGRRSTL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|