C22H23N5O5S — CID 26366113
2-methoxy-3-nitro-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol (PubChem CID 26366113) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is 2-methoxy-3-nitro-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol.
| Compound Name | 2-methoxy-3-nitro-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol |
|---|---|
| PubChem CID | 26366113 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 2-methoxy-3-nitro-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]phenol |
| SMILES | CCCCCSc1nnc2c(n1)O[C@H](c1ccc(O)c(OC)c1[N+](=O)[O-])Nc1ccccc1-2 |
| InChI | InChI=1S/C22H23N5O5S/c1-3-4-7-12-33-22-24-21-17(25-26-22)13-8-5-6-9-15(13)23-20(32-21)14-10-11-16(28)19(31-2)18(14)27(29)30/h5-6,8-11,20,23,28H,3-4,7,12H2,1-2H3/t20-/m1/s1 |
| InChIKey | CWTNKMDJCNSKQG-HXUWFJFHSA-N |
| XLogP | 4.95 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|