C23H27N5OS — CID 6405990
N,N-dimethyl-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline (PubChem CID 6405990) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is N,N-dimethyl-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline.
| Compound Name | N,N-dimethyl-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline |
|---|---|
| PubChem CID | 6405990 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N,N-dimethyl-4-[(6R)-3-pentylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline |
| SMILES | CCCCCSc1nnc2c(n1)O[C@H](c1ccc(N(C)C)cc1)Nc1ccccc1-2 |
| InChI | InChI=1S/C23H27N5OS/c1-4-5-8-15-30-23-25-22-20(26-27-23)18-9-6-7-10-19(18)24-21(29-22)16-11-13-17(14-12-16)28(2)3/h6-7,9-14,21,24H,4-5,8,15H2,1-3H3/t21-/m1/s1 |
| InChIKey | LBOBTPMMMSGYAO-OAQYLSRUSA-N |
| XLogP | 5.39 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|