C21H23N5OS — CID 6404762
N,N-diethyl-4-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline (PubChem CID 6404762) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is N,N-diethyl-4-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline.
| Compound Name | N,N-diethyl-4-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline |
|---|---|
| PubChem CID | 6404762 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N,N-diethyl-4-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]aniline |
| SMILES | CCN(CC)c1ccc([C@@H]2Nc3ccccc3-c3nnc(SC)nc3O2)cc1 |
| InChI | InChI=1S/C21H23N5OS/c1-4-26(5-2)15-12-10-14(11-13-15)19-22-17-9-7-6-8-16(17)18-20(27-19)23-21(28-3)25-24-18/h6-13,19,22H,4-5H2,1-3H3/t19-/m1/s1 |
| InChIKey | PBBQXLZGOFZIOY-LJQANCHMSA-N |
| XLogP | 4.61 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |